CAS 2727885-13-2 is the registry number for tert-Butyl methyl((1S,2S)-2-(methylamino)cyclopropyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-methyl-N-[(1S,2S)-2-(methylamino)cyclopropyl]carbamate (CAS 2727885-13-2) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-methyl-N-[(1S,2S)-2-(methylamino)cyclopropyl]carbamate. InChIKey: FKUGJWUJHJIZRU-YUMQZZPRSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-methyl-N-[(1S,2S)-2-(methylamino)cyclopropyl]carbamate |
| InChIKey | FKUGJWUJHJIZRU-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@H]1C[C@@H]1NC |
Computed by PubChem (NCBI)