CAS 2728-59-8 is the registry number for 3-Bromo-N-(2-chloro-5-(trifluoromethyl)phenyl)propanamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-N-[2-chloro-5-(trifluoromethyl)phenyl]propanamide (CAS 2728-59-8) is a chemical compound with the molecular formula C10H8BrClF3NO and a molecular weight of 330.53 g/mol. IUPAC name: 3-bromo-N-[2-chloro-5-(trifluoromethyl)phenyl]propanamide. InChIKey: OASPNOKQXOSUJR-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClF3NO |
|---|---|
| Molecular weight | 330.53 g/mol |
| IUPAC name | 3-bromo-N-[2-chloro-5-(trifluoromethyl)phenyl]propanamide |
| InChIKey | OASPNOKQXOSUJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)NC(=O)CCBr)Cl |
Computed by PubChem (NCBI)