CAS 2730-58-7 is the registry number for Ammonium pentafluoropropionate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Azanium 2,2,3,3,3-pentafluoropropanoate (CAS 2730-58-7) is a chemical compound with the molecular formula C3H4F5NO2 and a molecular weight of 181.06 g/mol. IUPAC name: azanium 2,2,3,3,3-pentafluoropropanoate. InChIKey: NBNLXUGHUHZAPZ-UHFFFAOYSA-N.
| Molecular formula | C3H4F5NO2 |
|---|---|
| Molecular weight | 181.06 g/mol |
| IUPAC name | azanium 2,2,3,3,3-pentafluoropropanoate |
| InChIKey | NBNLXUGHUHZAPZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(F)(F)F)(F)F)[O-].[NH4+] |
Computed by PubChem (NCBI)