Products 2730879-64-6
CAS 2730879-64-6 is the registry number for Ethyl 2-(4-chloro-7-isopropyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2(1H)-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(4-chloro-1-oxo-7-propan-2-ylpyrrolo[1,2-d][1,2,4]triazin-2-yl)acetate (CAS 2730879-64-6) is a chemical compound with the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. IUPAC name: ethyl 2-(4-chloro-1-oxo-7-propan-2-ylpyrrolo[1,2-d][1,2,4]triazin-2-yl)acetate. InChIKey: PQMNSTMBSVRYNG-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3O3 |
|---|---|
| Molecular weight | 297.74 g/mol |
| IUPAC name | ethyl 2-(4-chloro-1-oxo-7-propan-2-ylpyrrolo[1,2-d][1,2,4]triazin-2-yl)acetate |
| InChIKey | PQMNSTMBSVRYNG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C(=O)C2=CC(=CN2C(=N1)Cl)C(C)C |
Computed by PubChem (NCBI)