Products 2730887-93-9
CAS 2730887-93-9 is the registry number for 2-(Difluoromethyl)imidazo[1,2-a]pyridin-6-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(difluoromethyl)imidazo[1,2-a]pyridin-6-amine (CAS 2730887-93-9) is a chemical compound with the molecular formula C8H7F2N3 and a molecular weight of 183.16 g/mol. IUPAC name: 2-(difluoromethyl)imidazo[1,2-a]pyridin-6-amine. InChIKey: PSZYYQJIGWHHED-UHFFFAOYSA-N.
| Molecular formula | C8H7F2N3 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 2-(difluoromethyl)imidazo[1,2-a]pyridin-6-amine |
| InChIKey | PSZYYQJIGWHHED-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1N)C(F)F |
Computed by PubChem (NCBI)