CAS 2731008-15-2 is the registry number for 2-(2,5-Bis(trifluoromethyl)thiazol-4-yl)-2,2-difluoroacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2,5-bis(trifluoromethyl)-1,3-thiazol-4-yl]-2,2-difluoroacetic acid (CAS 2731008-15-2) is a chemical compound with the molecular formula C7HF8NO2S and a molecular weight of 315.14 g/mol. IUPAC name: 2-[2,5-bis(trifluoromethyl)-1,3-thiazol-4-yl]-2,2-difluoroacetic acid. InChIKey: MSYMLYUAPFGBHS-UHFFFAOYSA-N.
| Molecular formula | C7HF8NO2S |
|---|---|
| Molecular weight | 315.14 g/mol |
| IUPAC name | 2-[2,5-bis(trifluoromethyl)-1,3-thiazol-4-yl]-2,2-difluoroacetic acid |
| InChIKey | MSYMLYUAPFGBHS-UHFFFAOYSA-N |
| SMILES | C1(=C(SC(=N1)C(F)(F)F)C(F)(F)F)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)