CAS 2731012-82-9 is the registry number for tert-Butyl ((1R,2R)-2-((tert-butyldimethylsilyl)oxy)-4-hydroxycyclopentyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxycyclopentyl]carbamate (CAS 2731012-82-9) is a chemical compound with the molecular formula C16H33NO4Si and a molecular weight of 331.52 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxycyclopentyl]carbamate. InChIKey: ZYPAGQSDTWTOLT-VFRRUGBOSA-N.
| Molecular formula | C16H33NO4Si |
|---|---|
| Molecular weight | 331.52 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxycyclopentyl]carbamate |
| InChIKey | ZYPAGQSDTWTOLT-VFRRUGBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC(C[C@H]1O[Si](C)(C)C(C)(C)C)O |
Computed by PubChem (NCBI)