CAS 1792185-03-5 is the registry number for tert-Butyl (3S,5S)-3-((tert-butyldimethylsilyl)oxy)-5-hydroxypiperidine-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypiperidine-1-carboxylate (CAS 1792185-03-5) is a chemical compound with the molecular formula C16H33NO4Si and a molecular weight of 331.52 g/mol. IUPAC name: tert-butyl (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypiperidine-1-carboxylate. InChIKey: PUEAOZNPUCMJCE-STQMWFEESA-N.
| Molecular formula | C16H33NO4Si |
|---|---|
| Molecular weight | 331.52 g/mol |
| IUPAC name | tert-butyl (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypiperidine-1-carboxylate |
| InChIKey | PUEAOZNPUCMJCE-STQMWFEESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H](C1)O[Si](C)(C)C(C)(C)C)O |
Computed by PubChem (NCBI)