CAS 2731368-99-1 is the registry number for Proxymetacaine N-Oxide Dihydrochloride. Offered by: Mikromol. Available pack sizes: 50mg.
2-(3-amino-4-propoxybenzoyl)oxy-N,N-diethylethanamine oxide;dihydrochloride (CAS 2731368-99-1) is a chemical compound with the molecular formula C16H28Cl2N2O4 and a molecular weight of 383.3 g/mol. IUPAC name: 2-(3-amino-4-propoxybenzoyl)oxy-N,N-diethylethanamine oxide;dihydrochloride. InChIKey: SPIXHLTYCFSSMT-UHFFFAOYSA-N.
| Molecular formula | C16H28Cl2N2O4 |
|---|---|
| Molecular weight | 383.3 g/mol |
| IUPAC name | 2-(3-amino-4-propoxybenzoyl)oxy-N,N-diethylethanamine oxide;dihydrochloride |
| InChIKey | SPIXHLTYCFSSMT-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1)C(=O)OCC[N+](CC)(CC)[O-])N.Cl.Cl |
Computed by PubChem (NCBI)