CAS 2731414-17-6 is the registry number for Perphenazine Sulfoxide N1-Oxide (Perphenazine N1,S-Dioxide). Offered by: Mikromol. Available pack sizes: 25mg.
2-[4-[3-(2-chloro-5-oxophenothiazin-10-yl)propyl]-1-oxidopiperazin-1-ium-1-yl]ethanol (CAS 2731414-17-6) is a chemical compound with the molecular formula C21H26ClN3O3S and a molecular weight of 436.0 g/mol. IUPAC name: 2-[4-[3-(2-chloro-5-oxophenothiazin-10-yl)propyl]-1-oxidopiperazin-1-ium-1-yl]ethanol. InChIKey: NFGFVNMYTZTVPC-UHFFFAOYSA-N.
| Molecular formula | C21H26ClN3O3S |
|---|---|
| Molecular weight | 436.0 g/mol |
| IUPAC name | 2-[4-[3-(2-chloro-5-oxophenothiazin-10-yl)propyl]-1-oxidopiperazin-1-ium-1-yl]ethanol |
| InChIKey | NFGFVNMYTZTVPC-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCN1CCCN2C3=CC=CC=C3S(=O)C4=C2C=C(C=C4)Cl)(CCO)[O-] |
Computed by PubChem (NCBI)