CAS 2731671-51-3 is the registry number for Buflomedil N-Oxide Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg.
4-(1-oxidopyrrolidin-1-ium-1-yl)-1-(2,4,6-trimethoxyphenyl)butan-1-one;hydrochloride (CAS 2731671-51-3) is a chemical compound with the molecular formula C17H26ClNO5 and a molecular weight of 359.8 g/mol. IUPAC name: 4-(1-oxidopyrrolidin-1-ium-1-yl)-1-(2,4,6-trimethoxyphenyl)butan-1-one;hydrochloride. InChIKey: BGNKMKFPHXUVGN-UHFFFAOYSA-N.
| Molecular formula | C17H26ClNO5 |
|---|---|
| Molecular weight | 359.8 g/mol |
| IUPAC name | 4-(1-oxidopyrrolidin-1-ium-1-yl)-1-(2,4,6-trimethoxyphenyl)butan-1-one;hydrochloride |
| InChIKey | BGNKMKFPHXUVGN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)CCC[N+]2(CCCC2)[O-])OC.Cl |
Computed by PubChem (NCBI)