CAS 2731709-13-8 is the registry number for Disopyramide N-Oxide Dihydrochloride. Offered by: Mikromol. Available pack sizes: 25mg.
4-amino-4-oxo-3-phenyl-N,N-di(propan-2-yl)-3-pyridin-2-ylbutan-1-amine oxide;hydrochloride (CAS 2731709-13-8) is a chemical compound with the molecular formula C21H30ClN3O2 and a molecular weight of 391.9 g/mol. IUPAC name: 4-amino-4-oxo-3-phenyl-N,N-di(propan-2-yl)-3-pyridin-2-ylbutan-1-amine oxide;hydrochloride. InChIKey: BDWRAKLBWANCRL-UHFFFAOYSA-N.
| Molecular formula | C21H30ClN3O2 |
|---|---|
| Molecular weight | 391.9 g/mol |
| IUPAC name | 4-amino-4-oxo-3-phenyl-N,N-di(propan-2-yl)-3-pyridin-2-ylbutan-1-amine oxide;hydrochloride |
| InChIKey | BDWRAKLBWANCRL-UHFFFAOYSA-N |
| SMILES | CC(C)[N+](CCC(C1=CC=CC=C1)(C2=CC=CC=N2)C(=O)N)(C(C)C)[O-].Cl |
Computed by PubChem (NCBI)