CAS 2731709-15-0 is the registry number for 4-((1RS)-2-(tert-Butylamino)-1-hydroxyethyl)-2-ethylphenol Hydrobromide. Offered by: Mikromol. Available pack sizes: 25mg.
4-[2-(tert-butylamino)-1-hydroxyethyl]-2-ethylphenol;hydrobromide (CAS 2731709-15-0) is a chemical compound with the molecular formula C14H24BrNO2 and a molecular weight of 318.25 g/mol. IUPAC name: 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-ethylphenol;hydrobromide. InChIKey: OIVWHHSFMFPDNC-UHFFFAOYSA-N.
| Molecular formula | C14H24BrNO2 |
|---|---|
| Molecular weight | 318.25 g/mol |
| IUPAC name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-ethylphenol;hydrobromide |
| InChIKey | OIVWHHSFMFPDNC-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)C(CNC(C)(C)C)O)O.Br |
Computed by PubChem (NCBI)