CAS 2732400-56-3 is the registry number for Selexipag Metabolite N-Oxide (MRE-269 N-Oxide, ACT-333679 N-Oxide). Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-[(4-oxido-5,6-diphenylpyrazin-4-ium-2-yl)-propan-2-ylamino]butoxy]acetic acid (CAS 2732400-56-3) is a chemical compound with the molecular formula C25H29N3O4 and a molecular weight of 435.5 g/mol. IUPAC name: 2-[4-[(4-oxido-5,6-diphenylpyrazin-4-ium-2-yl)-propan-2-ylamino]butoxy]acetic acid. InChIKey: JSPFDHDJJSQQPY-UHFFFAOYSA-N.
| Molecular formula | C25H29N3O4 |
|---|---|
| Molecular weight | 435.5 g/mol |
| IUPAC name | 2-[4-[(4-oxido-5,6-diphenylpyrazin-4-ium-2-yl)-propan-2-ylamino]butoxy]acetic acid |
| InChIKey | JSPFDHDJJSQQPY-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCCCOCC(=O)O)C1=C[N+](=C(C(=N1)C2=CC=CC=C2)C3=CC=CC=C3)[O-] |
Computed by PubChem (NCBI)