CAS 2732673-11-7 is the registry number for Didesethylflurazepam Hydrochloride. Offered by: LoGiCal. Available pack sizes: 5mg.
1-(2-aminoethyl)-7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one;hydrochloride (CAS 2732673-11-7) is a chemical compound with the molecular formula C17H16Cl2FN3O and a molecular weight of 368.2 g/mol. IUPAC name: 1-(2-aminoethyl)-7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one;hydrochloride. InChIKey: FCWWMASRHFZORN-UHFFFAOYSA-N.
| Molecular formula | C17H16Cl2FN3O |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | 1-(2-aminoethyl)-7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one;hydrochloride |
| InChIKey | FCWWMASRHFZORN-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3F)CCN.Cl |
Computed by PubChem (NCBI)