Products 2732673-27-5

CAS 2732673-27-5 is the registry number for 2-Ethyl-2-phenalacetylguanidine Sulphate. Offered by: Mikromol. Available pack sizes: 4x25mg, 25mg, 100mg.

Structural formula: {0} (CAS {1})

N-(diaminomethylidene)-2-phenylbutanamide;sulfuric acid (CAS 2732673-27-5) is a chemical compound with the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. IUPAC name: N-(diaminomethylidene)-2-phenylbutanamide;sulfuric acid. InChIKey: XFUOOOSDWYVAOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17N3O5S
Molecular weight303.34 g/mol
IUPAC nameN-(diaminomethylidene)-2-phenylbutanamide;sulfuric acid
InChIKeyXFUOOOSDWYVAOJ-UHFFFAOYSA-N
SMILESCCC(C1=CC=CC=C1)C(=O)N=C(N)N.OS(=O)(=O)O

Computed by PubChem (NCBI)