CAS 2732673-27-5 is the registry number for 2-Ethyl-2-phenalacetylguanidine Sulphate. Offered by: Mikromol. Available pack sizes: 4x25mg, 25mg, 100mg.
N-(diaminomethylidene)-2-phenylbutanamide;sulfuric acid (CAS 2732673-27-5) is a chemical compound with the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. IUPAC name: N-(diaminomethylidene)-2-phenylbutanamide;sulfuric acid. InChIKey: XFUOOOSDWYVAOJ-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O5S |
|---|---|
| Molecular weight | 303.34 g/mol |
| IUPAC name | N-(diaminomethylidene)-2-phenylbutanamide;sulfuric acid |
| InChIKey | XFUOOOSDWYVAOJ-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=CC=C1)C(=O)N=C(N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)