CAS 2732834-98-7 is the registry number for Phosmet-oxon D6 (dimethyl D6). Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg.
2-[bis(trideuteriomethoxy)phosphorylsulfanylmethyl]isoindole-1,3-dione (CAS 2732834-98-7) is a chemical compound with the molecular formula C11H12NO5PS and a molecular weight of 307.29 g/mol. IUPAC name: 2-[bis(trideuteriomethoxy)phosphorylsulfanylmethyl]isoindole-1,3-dione. InChIKey: BEMXOWRVWRNPPL-WFGJKAKNSA-N.
| Molecular formula | C11H12NO5PS |
|---|---|
| Molecular weight | 307.29 g/mol |
| IUPAC name | 2-[bis(trideuteriomethoxy)phosphorylsulfanylmethyl]isoindole-1,3-dione |
| InChIKey | BEMXOWRVWRNPPL-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OP(=O)(OC([2H])([2H])[2H])SCN1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)