CAS 2732862-38-1 appears in our catalog under these names: Clofentezine-d8, >95% (HPLC), Clofentezine-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 2,5mg, 1 mg, 10 mg, 2.5 mg.
3,6-bis(2-chloro-3,4,5,6-tetradeuteriophenyl)-1,2,4,5-tetrazine (CAS 2732862-38-1) is a chemical compound with the molecular formula C14H8Cl2N4 and a molecular weight of 311.2 g/mol. IUPAC name: 3,6-bis(2-chloro-3,4,5,6-tetradeuteriophenyl)-1,2,4,5-tetrazine. InChIKey: UXADOQPNKNTIHB-PGRXLJNUSA-N.
| Molecular formula | C14H8Cl2N4 |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | 3,6-bis(2-chloro-3,4,5,6-tetradeuteriophenyl)-1,2,4,5-tetrazine |
| InChIKey | UXADOQPNKNTIHB-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2=NN=C(N=N2)C3=C(C(=C(C(=C3Cl)[2H])[2H])[2H])[2H])Cl)[2H])[2H] |
Computed by PubChem (NCBI)