CAS 2732926-24-6 is the registry number for N-Desethyl Isotonitazene. Offered by: TRC. Available pack sizes: 250mg.
N-ethyl-2-[5-nitro-2-[(4-propan-2-yloxyphenyl)methyl]benzimidazol-1-yl]ethanamine (CAS 2732926-24-6) is a chemical compound with the molecular formula C21H26N4O3 and a molecular weight of 382.5 g/mol. IUPAC name: N-ethyl-2-[5-nitro-2-[(4-propan-2-yloxyphenyl)methyl]benzimidazol-1-yl]ethanamine. InChIKey: HHBRZWRJZICFRP-UHFFFAOYSA-N.
| Molecular formula | C21H26N4O3 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | N-ethyl-2-[5-nitro-2-[(4-propan-2-yloxyphenyl)methyl]benzimidazol-1-yl]ethanamine |
| InChIKey | HHBRZWRJZICFRP-UHFFFAOYSA-N |
| SMILES | CCNCCN1C2=C(C=C(C=C2)[N+](=O)[O-])N=C1CC3=CC=C(C=C3)OC(C)C |
Computed by PubChem (NCBI)