Products 2732980-95-7
CAS 2732980-95-7 is the registry number for Amifampridine-d3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2,5,6-trideuteriopyridine-3,4-diamine (CAS 2732980-95-7) is a chemical compound with the molecular formula C5H7N3 and a molecular weight of 112.15 g/mol. IUPAC name: 2,5,6-trideuteriopyridine-3,4-diamine. InChIKey: OYTKINVCDFNREN-CBYSEHNBSA-N.
| Molecular formula | C5H7N3 |
|---|---|
| Molecular weight | 112.15 g/mol |
| IUPAC name | 2,5,6-trideuteriopyridine-3,4-diamine |
| InChIKey | OYTKINVCDFNREN-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(N=C(C(=C1N)N)[2H])[2H] |
Computed by PubChem (NCBI)