CAS 2733162-45-1 is the registry number for 1,1'-Sulfonylbis(2-(methyl-d3-thio)ethane), 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,01g, 0,005g.
1-(trideuteriomethylsulfanyl)-2-[2-(trideuteriomethylsulfanyl)ethylsulfonyl]ethane (CAS 2733162-45-1) is a chemical compound with the molecular formula C6H14O2S3 and a molecular weight of 220.4 g/mol. IUPAC name: 1-(trideuteriomethylsulfanyl)-2-[2-(trideuteriomethylsulfanyl)ethylsulfonyl]ethane. InChIKey: IMRNRNZPCBFCKC-WFGJKAKNSA-N.
| Molecular formula | C6H14O2S3 |
|---|---|
| Molecular weight | 220.4 g/mol |
| IUPAC name | 1-(trideuteriomethylsulfanyl)-2-[2-(trideuteriomethylsulfanyl)ethylsulfonyl]ethane |
| InChIKey | IMRNRNZPCBFCKC-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])SCCS(=O)(=O)CCSC([2H])([2H])[2H] |
Computed by PubChem (NCBI)