CAS 2733342-93-1 appears in our catalog under these names: (S)–LY3177833 hydrate, (S)-LY3177833 (hydrate). Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 5 mg, 100 mg, 10 mg, 50 mg, 25 mg.
(3S)-3-(5-fluoropyrimidin-4-yl)-3-methyl-6-(1H-pyrazol-4-yl)-2H-isoindol-1-one;hydrate (CAS 2733342-93-1) is a chemical compound with the molecular formula C16H14FN5O2 and a molecular weight of 327.31 g/mol. IUPAC name: (3S)-3-(5-fluoropyrimidin-4-yl)-3-methyl-6-(1H-pyrazol-4-yl)-2H-isoindol-1-one;hydrate. InChIKey: WSICFXBHDWUFRU-NTISSMGPSA-N.
| Molecular formula | C16H14FN5O2 |
|---|---|
| Molecular weight | 327.31 g/mol |
| IUPAC name | (3S)-3-(5-fluoropyrimidin-4-yl)-3-methyl-6-(1H-pyrazol-4-yl)-2H-isoindol-1-one;hydrate |
| InChIKey | WSICFXBHDWUFRU-NTISSMGPSA-N |
| SMILES | C[C@]1(C2=C(C=C(C=C2)C3=CNN=C3)C(=O)N1)C4=NC=NC=C4F.O |
Computed by PubChem (NCBI)