CAS 2733532-11-9 appears in our catalog under these names: Glyphosate-C3-d2, >95% (HPLC), N-Phosphonomethyl-d2-glycine, 99 atom % D, min 98% Chemical Purity, Glyphosate-d2, 99.73%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 0,01g, 0,005g, 1 mg.
2-[[dideuterio(phosphono)methyl]amino]acetic acid (CAS 2733532-11-9) is a chemical compound with the molecular formula C3H8NO5P and a molecular weight of 171.09 g/mol. IUPAC name: 2-[[dideuterio(phosphono)methyl]amino]acetic acid. InChIKey: XDDAORKBJWWYJS-CBTSVUPCSA-N.
| Molecular formula | C3H8NO5P |
|---|---|
| Molecular weight | 171.09 g/mol |
| IUPAC name | 2-[[dideuterio(phosphono)methyl]amino]acetic acid |
| InChIKey | XDDAORKBJWWYJS-CBTSVUPCSA-N |
| SMILES | [2H]C([2H])(NCC(=O)O)P(=O)(O)O |
Computed by PubChem (NCBI)