CAS 2733559-95-8 is the registry number for Allopurinol-13C,15N2, D2. Offered by: TRC. Available pack sizes: 25mg.
3,6-dideuterio-1,7-dihydro(1,2-15N2)pyrazolo[5,4-d](213C)pyrimidin-4-one (CAS 2733559-95-8) is a chemical compound with the molecular formula C5H4N4O and a molecular weight of 141.10 g/mol. IUPAC name: 3,6-dideuterio-1,7-dihydro(1,2-15N2)pyrazolo[5,4-d](213C)pyrimidin-4-one. InChIKey: OFCNXPDARWKPPY-NIHFPGJVSA-N.
| Molecular formula | C5H4N4O |
|---|---|
| Molecular weight | 141.10 g/mol |
| IUPAC name | 3,6-dideuterio-1,7-dihydro(1,2-15N2)pyrazolo[5,4-d](213C)pyrimidin-4-one |
| InChIKey | OFCNXPDARWKPPY-NIHFPGJVSA-N |
| SMILES | [2H]C1=[15N][15NH]C2=C1C(=O)N=[13C](N2)[2H] |
Computed by PubChem (NCBI)