Products 2733572-66-0
CAS 2733572-66-0 is the registry number for N-(4-Amino-3-pyridinyl)-acetamide-d3 Hydrochloride. Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
N-(4-amino-2,5,6-trideuterio-3-pyridinyl)acetamide;hydrochloride (CAS 2733572-66-0) is a chemical compound with the molecular formula C7H10ClN3O and a molecular weight of 190.64 g/mol. IUPAC name: N-(4-amino-2,5,6-trideuterio-3-pyridinyl)acetamide;hydrochloride. InChIKey: UKIVUJBWGQQMPB-OKTCPNCBSA-N.
| Molecular formula | C7H10ClN3O |
|---|---|
| Molecular weight | 190.64 g/mol |
| IUPAC name | N-(4-amino-2,5,6-trideuterio-3-pyridinyl)acetamide;hydrochloride |
| InChIKey | UKIVUJBWGQQMPB-OKTCPNCBSA-N |
| SMILES | [2H]C1=C(N=C(C(=C1N)NC(=O)C)[2H])[2H].Cl |
Computed by PubChem (NCBI)