CAS 2733627-15-9 is the registry number for Prometryn D6 (isopropyl D6) 100 µg/mL in Acetone. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
2-N-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-6-methylsulfanyl-4-N-propan-2-yl-1,3,5-triazine-2,4-diamine (CAS 2733627-15-9) is a chemical compound with the molecular formula C10H19N5S and a molecular weight of 247.40 g/mol. IUPAC name: 2-N-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-6-methylsulfanyl-4-N-propan-2-yl-1,3,5-triazine-2,4-diamine. InChIKey: AAEVYOVXGOFMJO-WFGJKAKNSA-N.
| Molecular formula | C10H19N5S |
|---|---|
| Molecular weight | 247.40 g/mol |
| IUPAC name | 2-N-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-6-methylsulfanyl-4-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| InChIKey | AAEVYOVXGOFMJO-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])NC1=NC(=NC(=N1)SC)NC(C)C |
Computed by PubChem (NCBI)