CAS 2733717-19-4 appears in our catalog under these names: 4-Hydroxy-3-methoxy-d3-benzoic Acid, 99 atom % D, min 98% Chemical Purity, Vanillic-d3 Acid, >95% (HPLC). Offered by: CDN, TRC. Available pack sizes: 0,01g, 0,005g, 1mg, 2,5mg.
4-hydroxy-3-(trideuteriomethoxy)benzoic acid (CAS 2733717-19-4) is a chemical compound with the molecular formula C8H8O4 and a molecular weight of 171.16 g/mol. IUPAC name: 4-hydroxy-3-(trideuteriomethoxy)benzoic acid. InChIKey: WKOLLVMJNQIZCI-FIBGUPNXSA-N.
| Molecular formula | C8H8O4 |
|---|---|
| Molecular weight | 171.16 g/mol |
| IUPAC name | 4-hydroxy-3-(trideuteriomethoxy)benzoic acid |
| InChIKey | WKOLLVMJNQIZCI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)C(=O)O)O |
Computed by PubChem (NCBI)