CAS 2733721-65-6 is the registry number for Bisphenol A monosulfate-d6 (sodium). Offered by: MedChemExpress. Available pack sizes: 1 mg.
Sodium [4-[1,1,1,3,3,3-hexadeuterio-2-(4-hydroxyphenyl)propan-2-yl]phenyl] sulfate (CAS 2733721-65-6) is a chemical compound with the molecular formula C15H15NaO5S and a molecular weight of 336.4 g/mol. IUPAC name: sodium [4-[1,1,1,3,3,3-hexadeuterio-2-(4-hydroxyphenyl)propan-2-yl]phenyl] sulfate. InChIKey: IENSPWAUWOIJJS-TXHXQZCNSA-M.
| Molecular formula | C15H15NaO5S |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | sodium [4-[1,1,1,3,3,3-hexadeuterio-2-(4-hydroxyphenyl)propan-2-yl]phenyl] sulfate |
| InChIKey | IENSPWAUWOIJJS-TXHXQZCNSA-M |
| SMILES | [2H]C([2H])([2H])C(C1=CC=C(C=C1)O)(C2=CC=C(C=C2)OS(=O)(=O)[O-])C([2H])([2H])[2H].[Na+] |
Computed by PubChem (NCBI)