Products 2734084-16-1
CAS 2734084-16-1 is the registry number for Cinnarizine N4-Oxide Dihydrochloride. Offered by: Mikromol. Available pack sizes: 25mg.
4-benzhydryl-1-oxido-1-[(E)-3-phenylprop-2-enyl]piperazin-1-ium;hydrochloride (CAS 2734084-16-1) is a chemical compound with the molecular formula C26H29ClN2O and a molecular weight of 421.0 g/mol. IUPAC name: 4-benzhydryl-1-oxido-1-[(E)-3-phenylprop-2-enyl]piperazin-1-ium;hydrochloride. InChIKey: RFZFRRKUNBYYPK-RSGUCCNWSA-N.
| Molecular formula | C26H29ClN2O |
|---|---|
| Molecular weight | 421.0 g/mol |
| IUPAC name | 4-benzhydryl-1-oxido-1-[(E)-3-phenylprop-2-enyl]piperazin-1-ium;hydrochloride |
| InChIKey | RFZFRRKUNBYYPK-RSGUCCNWSA-N |
| SMILES | C1C[N+](CCN1C(C2=CC=CC=C2)C3=CC=CC=C3)(C/C=C/C4=CC=CC=C4)[O-].Cl |
Computed by PubChem (NCBI)
Synonyms:
Cinnarizine N4-Oxide Dihydrochloride