Products 2734302-95-3
CAS 2734302-95-3 appears in our catalog under these names: 2-Benzylideneheptanal-d5, (contains E-isomer) (>85%), 2-Benzylideneheptanal-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 2,5mg, 5 mg, 1 mg.
(2Z)-2-[(2,3,4,5,6-pentadeuteriophenyl)methylidene]heptanal (CAS 2734302-95-3) is a chemical compound with the molecular formula C14H18O and a molecular weight of 207.32 g/mol. IUPAC name: (2Z)-2-[(2,3,4,5,6-pentadeuteriophenyl)methylidene]heptanal. InChIKey: HMKKIXGYKWDQSV-BOBKGOLOSA-N.
| Molecular formula | C14H18O |
|---|---|
| Molecular weight | 207.32 g/mol |
| IUPAC name | (2Z)-2-[(2,3,4,5,6-pentadeuteriophenyl)methylidene]heptanal |
| InChIKey | HMKKIXGYKWDQSV-BOBKGOLOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])/C=C(/CCCCC)\C=O)[2H])[2H] |
Computed by PubChem (NCBI)