CAS 2734379-03-2 appears in our catalog under these names: 4-Fluorobenzadehyde 2,4-Dinitrophenylhydrazone-3,5,6-d3, 99 atom % D, min 98% Chemical Purity, 4-Fluorobenzaldehyde 2,4-dinitrophenylhydrazone-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 5mg, 1mg.
2,3,5-trideuterio-N-[(E)-(4-fluorophenyl)methylideneamino]-4,6-dinitroaniline (CAS 2734379-03-2) is a chemical compound with the molecular formula C13H9FN4O4 and a molecular weight of 307.25 g/mol. IUPAC name: 2,3,5-trideuterio-N-[(E)-(4-fluorophenyl)methylideneamino]-4,6-dinitroaniline. InChIKey: WELVTVZWNPRATB-MTEYIRTJSA-N.
| Molecular formula | C13H9FN4O4 |
|---|---|
| Molecular weight | 307.25 g/mol |
| IUPAC name | 2,3,5-trideuterio-N-[(E)-(4-fluorophenyl)methylideneamino]-4,6-dinitroaniline |
| InChIKey | WELVTVZWNPRATB-MTEYIRTJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N/N=C/C2=CC=C(C=C2)F)[N+](=O)[O-])[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)