Products 2734417-02-6

CAS 2734417-02-6 is the registry number for Deferiprone EP Impurity C. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,2-dimethyl-4-methyliminopyridin-3-ol (CAS 2734417-02-6) is a chemical compound with the molecular formula C8H12N2O and a molecular weight of 152.19 g/mol. IUPAC name: 1,2-dimethyl-4-methyliminopyridin-3-ol. InChIKey: JKKRXSCNSDOKJN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2O
Molecular weight152.19 g/mol
IUPAC name1,2-dimethyl-4-methyliminopyridin-3-ol
InChIKeyJKKRXSCNSDOKJN-UHFFFAOYSA-N
SMILESCC1=C(C(=NC)C=CN1C)O

Computed by PubChem (NCBI)