Products 2734475-96-6
CAS 2734475-96-6 is the registry number for N–acetyl W–19. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
N-[4-[2-[(2Z)-2-(4-chlorophenyl)sulfonyliminopiperidin-1-yl]ethyl]phenyl]acetamide (CAS 2734475-96-6) is a chemical compound with the molecular formula C21H24ClN3O3S and a molecular weight of 434.0 g/mol. IUPAC name: N-[4-[2-[(2Z)-2-(4-chlorophenyl)sulfonyliminopiperidin-1-yl]ethyl]phenyl]acetamide. InChIKey: POQUVOZXJFOPBC-FLFQWRMESA-N.
| Molecular formula | C21H24ClN3O3S |
|---|---|
| Molecular weight | 434.0 g/mol |
| IUPAC name | N-[4-[2-[(2Z)-2-(4-chlorophenyl)sulfonyliminopiperidin-1-yl]ethyl]phenyl]acetamide |
| InChIKey | POQUVOZXJFOPBC-FLFQWRMESA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)CCN\2CCCC/C2=N/S(=O)(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)