CAS 2734706-69-3 appears in our catalog under these names: O-Phospho-L-Serine-13C3, L-O-Phosphoserine-13C315N, >95% (HPLC), O–Phospho–L–serine–13C3,15N, O-Phospho-L-serine-13C3,15N, 99.19%. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 0,5mg, 5mg, 500μg, 500 μg.
(2S)-2-(15N)azanyl-3-phosphonooxy(1,2,3-13C3)propanoic acid (CAS 2734706-69-3) is a chemical compound with the molecular formula C3H8NO6P and a molecular weight of 189.04 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-phosphonooxy(1,2,3-13C3)propanoic acid. InChIKey: BZQFBWGGLXLEPQ-UVYXLFMMSA-N.
| Molecular formula | C3H8NO6P |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-3-phosphonooxy(1,2,3-13C3)propanoic acid |
| InChIKey | BZQFBWGGLXLEPQ-UVYXLFMMSA-N |
| SMILES | [13CH2]([13C@@H]([13C](=O)O)[15NH2])OP(=O)(O)O |
Computed by PubChem (NCBI)