CAS 2734773-46-5 is the registry number for 2,2-Dichloro-1-(2,6-difluoro-4-methoxyphenyl)ethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,2-dichloro-1-(2,6-difluoro-4-methoxyphenyl)ethanol (CAS 2734773-46-5) is a chemical compound with the molecular formula C9H8Cl2F2O2 and a molecular weight of 257.06 g/mol. IUPAC name: 2,2-dichloro-1-(2,6-difluoro-4-methoxyphenyl)ethanol. InChIKey: UUIQEXRFTSKUAC-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2F2O2 |
|---|---|
| Molecular weight | 257.06 g/mol |
| IUPAC name | 2,2-dichloro-1-(2,6-difluoro-4-methoxyphenyl)ethanol |
| InChIKey | UUIQEXRFTSKUAC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)F)C(C(Cl)Cl)O)F |
Computed by PubChem (NCBI)