Products 2734775-44-9
CAS 2734775-44-9 is the registry number for 1,5-Dibromo-3-fluoro-2-isopropoxy-4-methylbenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1,5-dibromo-3-fluoro-2-methyl-4-propan-2-yloxybenzene (CAS 2734775-44-9) is a chemical compound with the molecular formula C10H11Br2FO and a molecular weight of 326.00 g/mol. IUPAC name: 1,5-dibromo-3-fluoro-2-methyl-4-propan-2-yloxybenzene. InChIKey: AYIUNHDDFIGSOD-UHFFFAOYSA-N.
| Molecular formula | C10H11Br2FO |
|---|---|
| Molecular weight | 326.00 g/mol |
| IUPAC name | 1,5-dibromo-3-fluoro-2-methyl-4-propan-2-yloxybenzene |
| InChIKey | AYIUNHDDFIGSOD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1Br)Br)OC(C)C)F |
Computed by PubChem (NCBI)