CAS 2734778-05-1 is the registry number for (2-Fluoro-3-isopropoxy-5-(trifluoromethyl)phenyl)(methyl)sulfane, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-fluoro-1-methylsulfanyl-3-propan-2-yloxy-5-(trifluoromethyl)benzene (CAS 2734778-05-1) is a chemical compound with the molecular formula C11H12F4OS and a molecular weight of 268.27 g/mol. IUPAC name: 2-fluoro-1-methylsulfanyl-3-propan-2-yloxy-5-(trifluoromethyl)benzene. InChIKey: OBUOUACXTWOBRU-UHFFFAOYSA-N.
| Molecular formula | C11H12F4OS |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 2-fluoro-1-methylsulfanyl-3-propan-2-yloxy-5-(trifluoromethyl)benzene |
| InChIKey | OBUOUACXTWOBRU-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=CC(=C1)C(F)(F)F)SC)F |
Computed by PubChem (NCBI)