CAS 2734778-07-3 is the registry number for 2-Fluoro-3-(methylthio)-5-(trifluoromethyl)benzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-fluoro-3-methylsulfanyl-5-(trifluoromethyl)benzoic acid (CAS 2734778-07-3) is a chemical compound with the molecular formula C9H6F4O2S and a molecular weight of 254.20 g/mol. IUPAC name: 2-fluoro-3-methylsulfanyl-5-(trifluoromethyl)benzoic acid. InChIKey: WFJROTNZQGTBKU-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2S |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | 2-fluoro-3-methylsulfanyl-5-(trifluoromethyl)benzoic acid |
| InChIKey | WFJROTNZQGTBKU-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=CC(=C1F)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)