Products 2734920-51-3
CAS 2734920-51-3 appears in our catalog under these names: trans-4-Hydroxy-L-proline-d4 (Major), >95% (HPLC), L-Hydroxyproline-d4, 99.94%. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
(2S,4R)-2,4,5,5-tetradeuterio-4-hydroxypyrrolidine-2-carboxylic acid (CAS 2734920-51-3) is a chemical compound with the molecular formula C5H9NO3 and a molecular weight of 135.15 g/mol. IUPAC name: (2S,4R)-2,4,5,5-tetradeuterio-4-hydroxypyrrolidine-2-carboxylic acid. InChIKey: PMMYEEVYMWASQN-AXWUYBSXSA-N.
| Molecular formula | C5H9NO3 |
|---|---|
| Molecular weight | 135.15 g/mol |
| IUPAC name | (2S,4R)-2,4,5,5-tetradeuterio-4-hydroxypyrrolidine-2-carboxylic acid |
| InChIKey | PMMYEEVYMWASQN-AXWUYBSXSA-N |
| SMILES | [2H][C@]1(C[C@@](C(N1)([2H])[2H])([2H])O)C(=O)O |
Computed by PubChem (NCBI)