CAS 2734920-69-3 appears in our catalog under these names: 1-Linolenoyl-3-chloropropanediol-d5, rac 1-Linolenoyl-3-chloropropanediol-d5. Offered by: MedChemExpress, TRC. Available pack sizes: 2.5 mg, 2,5mg, 25mg.
(3-chloro-1,1,2,3,3-pentadeuterio-2-hydroxypropyl) (9E,12E,15E)-octadeca-9,12,15-trienoate (CAS 2734920-69-3) is a chemical compound with the molecular formula C21H35ClO3 and a molecular weight of 376.0 g/mol. IUPAC name: (3-chloro-1,1,2,3,3-pentadeuterio-2-hydroxypropyl) (9E,12E,15E)-octadeca-9,12,15-trienoate. InChIKey: WMDJVMPIYSIHEJ-WHRJVOTOSA-N.
| Molecular formula | C21H35ClO3 |
|---|---|
| Molecular weight | 376.0 g/mol |
| IUPAC name | (3-chloro-1,1,2,3,3-pentadeuterio-2-hydroxypropyl) (9E,12E,15E)-octadeca-9,12,15-trienoate |
| InChIKey | WMDJVMPIYSIHEJ-WHRJVOTOSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])Cl)O)OC(=O)CCCCCCC/C=C/C/C=C/C/C=C/CC |
Computed by PubChem (NCBI)