Products 2734924-78-6
CAS 2734924-78-6 is the registry number for (R)-(1-Chloro-5,6,7,8-tetrahydroisoquinolin-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(5R)-1-chloro-5,6,7,8-tetrahydroisoquinolin-5-yl]methanol (CAS 2734924-78-6) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: [(5R)-1-chloro-5,6,7,8-tetrahydroisoquinolin-5-yl]methanol. InChIKey: PMSAFIHVOPEWBN-ZETCQYMHSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | [(5R)-1-chloro-5,6,7,8-tetrahydroisoquinolin-5-yl]methanol |
| InChIKey | PMSAFIHVOPEWBN-ZETCQYMHSA-N |
| SMILES | C1C[C@H](C2=C(C1)C(=NC=C2)Cl)CO |
Computed by PubChem (NCBI)