CAS 2734925-61-0 is the registry number for 8-Fluoro-7-(trifluoromethyl)-2,3-dihydro-4H-thiopyrano[3,2-c]pyridin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-fluoro-7-(trifluoromethyl)-2,3-dihydrothiopyrano[3,2-c]pyridin-4-one (CAS 2734925-61-0) is a chemical compound with the molecular formula C9H5F4NOS and a molecular weight of 251.20 g/mol. IUPAC name: 8-fluoro-7-(trifluoromethyl)-2,3-dihydrothiopyrano[3,2-c]pyridin-4-one. InChIKey: MYYMWAFOPJWBSA-UHFFFAOYSA-N.
| Molecular formula | C9H5F4NOS |
|---|---|
| Molecular weight | 251.20 g/mol |
| IUPAC name | 8-fluoro-7-(trifluoromethyl)-2,3-dihydrothiopyrano[3,2-c]pyridin-4-one |
| InChIKey | MYYMWAFOPJWBSA-UHFFFAOYSA-N |
| SMILES | C1CSC2=C(C(=NC=C2C1=O)C(F)(F)F)F |
Computed by PubChem (NCBI)