Products 2735654-88-1
CAS 2735654-88-1 is the registry number for (3S,4S)-4-Methoxypent-1-yn-3-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4S)-4-methoxypent-1-yn-3-amine;hydrochloride (CAS 2735654-88-1) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. IUPAC name: (3S,4S)-4-methoxypent-1-yn-3-amine;hydrochloride. InChIKey: SCSFUXLJPSJIOO-GEMLJDPKSA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 149.62 g/mol |
| IUPAC name | (3S,4S)-4-methoxypent-1-yn-3-amine;hydrochloride |
| InChIKey | SCSFUXLJPSJIOO-GEMLJDPKSA-N |
| SMILES | C[C@@H]([C@H](C#C)N)OC.Cl |
Computed by PubChem (NCBI)