CAS 2735700-95-3 is the registry number for (E)-2-(3,4-Difluorostyryl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(E)-2-(3,4-difluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2735700-95-3) is a chemical compound with the molecular formula C14H17BF2O2 and a molecular weight of 266.09 g/mol. IUPAC name: 2-[(E)-2-(3,4-difluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FKVUIKJCALEDPM-BQYQJAHWSA-N.
| Molecular formula | C14H17BF2O2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 2-[(E)-2-(3,4-difluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FKVUIKJCALEDPM-BQYQJAHWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)