Products 2736155-90-9
CAS 2736155-90-9 is the registry number for 7-Bromo-6-fluoro-2,3-dihydrobenzofuran-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-6-fluoro-2,3-dihydro-1-benzofuran-5-carboxylic acid (CAS 2736155-90-9) is a chemical compound with the molecular formula C9H6BrFO3 and a molecular weight of 261.04 g/mol. IUPAC name: 7-bromo-6-fluoro-2,3-dihydro-1-benzofuran-5-carboxylic acid. InChIKey: FTZRLHMIOOVBRR-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO3 |
|---|---|
| Molecular weight | 261.04 g/mol |
| IUPAC name | 7-bromo-6-fluoro-2,3-dihydro-1-benzofuran-5-carboxylic acid |
| InChIKey | FTZRLHMIOOVBRR-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C(=C(C=C21)C(=O)O)F)Br |
Computed by PubChem (NCBI)