Products 2736597-76-3
CAS 2736597-76-3 is the registry number for benzyl 5,7-dichloro-3,4-dihydro-1H-2,6-naphthyridine-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 5,7-dichloro-3,4-dihydro-1H-2,6-naphthyridine-2-carboxylate (CAS 2736597-76-3) is a chemical compound with the molecular formula C16H14Cl2N2O2 and a molecular weight of 337.2 g/mol. IUPAC name: benzyl 5,7-dichloro-3,4-dihydro-1H-2,6-naphthyridine-2-carboxylate. InChIKey: CSRGMRZHEVGMCV-UHFFFAOYSA-N.
| Molecular formula | C16H14Cl2N2O2 |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | benzyl 5,7-dichloro-3,4-dihydro-1H-2,6-naphthyridine-2-carboxylate |
| InChIKey | CSRGMRZHEVGMCV-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC(=NC(=C21)Cl)Cl)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)