Products 2737202-65-0
CAS 2737202-65-0 is the registry number for N3-L-Cit-OH (DCHA). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-azido-5-(carbamoylamino)pentanoic acid;N-cyclohexylcyclohexanamine (CAS 2737202-65-0) is a chemical compound with the molecular formula C18H34N6O3 and a molecular weight of 382.5 g/mol. IUPAC name: (2S)-2-azido-5-(carbamoylamino)pentanoic acid;N-cyclohexylcyclohexanamine. InChIKey: PRCFSZNWPCQNEC-VWMHFEHESA-N.
| Molecular formula | C18H34N6O3 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | (2S)-2-azido-5-(carbamoylamino)pentanoic acid;N-cyclohexylcyclohexanamine |
| InChIKey | PRCFSZNWPCQNEC-VWMHFEHESA-N |
| SMILES | C1CCC(CC1)NC2CCCCC2.C(C[C@@H](C(=O)O)N=[N+]=[N-])CNC(=O)N |
Computed by PubChem (NCBI)