CAS 2737223-20-8 appears in our catalog under these names: Ho-peg7-ch2ch2cootbu, 95%, Hydroxy-PEG7-Boc 95%, tert-Butyl 1-hydroxy-3,6,9,12,15,18,21-heptaoxatetracosan-24-oate, 95%, 95%, Hydroxy-PEG7-Boc. Offered by: Combi-blocks, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 5g, 100mg, 25 mg, 50 mg, 100 mg.
Tert-butyl 3-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2737223-20-8) is a chemical compound with the molecular formula C21H42O10 and a molecular weight of 454.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: MEUULGVIOWAYGZ-UHFFFAOYSA-N.
| Molecular formula | C21H42O10 |
|---|---|
| Molecular weight | 454.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | MEUULGVIOWAYGZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)