Products 2738323-08-3
CAS 2738323-08-3 is the registry number for SARS-CoV-2-IN-75. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-tert-butyl-2-(4-tert-butyl-N-(2-chloroacetyl)anilino)-2-pyridin-3-ylacetamide (CAS 2738323-08-3) is a chemical compound with the molecular formula C23H30ClN3O2 and a molecular weight of 416.0 g/mol. IUPAC name: N-tert-butyl-2-(4-tert-butyl-N-(2-chloroacetyl)anilino)-2-pyridin-3-ylacetamide. InChIKey: RTMPWBZHQAQVCW-UHFFFAOYSA-N.
| Molecular formula | C23H30ClN3O2 |
|---|---|
| Molecular weight | 416.0 g/mol |
| IUPAC name | N-tert-butyl-2-(4-tert-butyl-N-(2-chloroacetyl)anilino)-2-pyridin-3-ylacetamide |
| InChIKey | RTMPWBZHQAQVCW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N(C(C2=CN=CC=C2)C(=O)NC(C)(C)C)C(=O)CCl |
Computed by PubChem (NCBI)
Synonyms:
SARS-CoV-2-IN-75, orb2565327