Products 2738332-94-8
CAS 2738332-94-8 is the registry number for QPy-TPA. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-2-pyridinyl]-1H-quinazolin-4-one (CAS 2738332-94-8) is a chemical compound with the molecular formula C33H24N4O and a molecular weight of 492.6 g/mol. IUPAC name: 2-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-2-pyridinyl]-1H-quinazolin-4-one. InChIKey: SWPCNQJOYYFODP-FOCLMDBBSA-N.
| Molecular formula | C33H24N4O |
|---|---|
| Molecular weight | 492.6 g/mol |
| IUPAC name | 2-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-2-pyridinyl]-1H-quinazolin-4-one |
| InChIKey | SWPCNQJOYYFODP-FOCLMDBBSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)/C=C/C4=CC(=NC=C4)C5=NC(=O)C6=CC=CC=C6N5 |
Computed by PubChem (NCBI)
Synonyms:
QPy-TPA, orb2565397